C24H25NO3 — CID 175640506
N,N-dimethyl-4-[2-(oxolan-2-ylmethoxy)naphthalen-1-yl]benzamide (PubChem CID 175640506) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(oxolan-2-ylmethoxy)naphthalen-1-yl]benzamide.
| Compound Name | N,N-dimethyl-4-[2-(oxolan-2-ylmethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 175640506 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N,N-dimethyl-4-[2-(oxolan-2-ylmethoxy)naphthalen-1-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2c(OCC3CCCO3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H25NO3/c1-25(2)24(26)19-11-9-18(10-12-19)23-21-8-4-3-6-17(21)13-14-22(23)28-16-20-7-5-15-27-20/h3-4,6,8-14,20H,5,7,15-16H2,1-2H3 |
| InChIKey | RDRSJNMEWHXMDQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |