C21H23N3O3 — CID 175642486
3,5-dimethyl-N-(4-quinolin-6-yloxycyclohexyl)-1,2-oxazole-4-carboxamide (PubChem CID 175642486) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-quinolin-6-yloxycyclohexyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-(4-quinolin-6-yloxycyclohexyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 175642486 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3,5-dimethyl-N-(4-quinolin-6-yloxycyclohexyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NC1CCC(Oc2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C21H23N3O3/c1-13-20(14(2)27-24-13)21(25)23-16-5-7-17(8-6-16)26-18-9-10-19-15(12-18)4-3-11-22-19/h3-4,9-12,16-17H,5-8H2,1-2H3,(H,23,25) |
| InChIKey | RAOYKZNCDZELLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |