C22H32N4O4 — CID 175642651
methyl 2-[[(1R,9S)-11-[(1R,3S)-3-aminocyclopentanecarbonyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]methyl-methylamino]acetate (PubChem CID 175642651) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl 2-[[(1R,9S)-11-[(1R,3S)-3-aminocyclopentanecarbonyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]methyl-methylamino]acetate.
| Compound Name | methyl 2-[[(1R,9S)-11-[(1R,3S)-3-aminocyclopentanecarbonyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]methyl-methylamino]acetate |
|---|---|
| PubChem CID | 175642651 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl 2-[[(1R,9S)-11-[(1R,3S)-3-aminocyclopentanecarbonyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]methyl-methylamino]acetate |
| SMILES | COC(=O)CN(C)Cc1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(C(=O)[C@@H]2CC[C@H](N)C2)C1 |
| InChI | InChI=1S/C22H32N4O4/c1-24(13-20(27)30-2)11-16-4-6-19-17-7-14(10-26(19)22(16)29)9-25(12-17)21(28)15-3-5-18(23)8-15/h4,6,14-15,17-18H,3,5,7-13,23H2,1-2H3/t14-,15+,17+,18-/m0/s1 |
| InChIKey | XEQKZAJOGXFAMN-IDCNUPLLSA-N |
| XLogP | 0.53 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |