C26H27NO4 — CID 175642946
[(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[5-(3,5-dimethoxyphenyl)naphthalen-2-yl]methanone (PubChem CID 175642946) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[5-(3,5-dimethoxyphenyl)naphthalen-2-yl]methanone.
| Compound Name | [(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[5-(3,5-dimethoxyphenyl)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 175642946 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[5-(3,5-dimethoxyphenyl)naphthalen-2-yl]methanone |
| SMILES | COc1cc(OC)cc(-c2cccc3cc(C(=O)N4C[C@H]5CC(O)C[C@H]5C4)ccc23)c1 |
| InChI | InChI=1S/C26H27NO4/c1-30-22-11-18(12-23(13-22)31-2)24-5-3-4-16-8-17(6-7-25(16)24)26(29)27-14-19-9-21(28)10-20(19)15-27/h3-8,11-13,19-21,28H,9-10,14-15H2,1-2H3/t19-,20+,21? |
| InChIKey | SLVJJIXKKFNTJY-WCRBZPEASA-N |
| XLogP | 4.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |