C24H21N3O2 — CID 175643089
4-[6-(1-methylindol-5-yl)naphthalene-2-carbonyl]piperazin-2-one (PubChem CID 175643089) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[6-(1-methylindol-5-yl)naphthalene-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[6-(1-methylindol-5-yl)naphthalene-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 175643089 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-[6-(1-methylindol-5-yl)naphthalene-2-carbonyl]piperazin-2-one |
| SMILES | Cn1ccc2cc(-c3ccc4cc(C(=O)N5CCNC(=O)C5)ccc4c3)ccc21 |
| InChI | InChI=1S/C24H21N3O2/c1-26-10-8-20-13-19(6-7-22(20)26)16-2-3-18-14-21(5-4-17(18)12-16)24(29)27-11-9-25-23(28)15-27/h2-8,10,12-14H,9,11,15H2,1H3,(H,25,28) |
| InChIKey | SBAAVVJLNKWDJZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |