C19H20N4OS — CID 175644993
(1R,9S)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175644993) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (1R,9S)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175644993 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (1R,9S)-4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1sc2ncnc(-c3cc4n(c(=O)c3)C[C@@H]3CNC[C@H]4C3)c2c1C |
| InChI | InChI=1S/C19H20N4OS/c1-10-11(2)25-19-17(10)18(21-9-22-19)13-4-15-14-3-12(6-20-7-14)8-23(15)16(24)5-13/h4-5,9,12,14,20H,3,6-8H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | KEHOWUBAPKTNGW-GXTWGEPZSA-N |
| XLogP | 2.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |