C18H33N3O2S — CID 175646624
2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-ylsulfanyl)-N-(2-ethoxycyclohexyl)acetamide (PubChem CID 175646624) has the molecular formula C18H33N3O2S and a molecular weight of 355.55 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-ylsulfanyl)-N-(2-ethoxycyclohexyl)acetamide.
| Compound Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-ylsulfanyl)-N-(2-ethoxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 175646624 |
| Molecular Formula | C18H33N3O2S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-ylsulfanyl)-N-(2-ethoxycyclohexyl)acetamide |
| SMILES | CCOC1CCCCC1NC(=O)CSC1NCNC2CCCCC21 |
| InChI | InChI=1S/C18H33N3O2S/c1-2-23-16-10-6-5-9-15(16)21-17(22)11-24-18-13-7-3-4-8-14(13)19-12-20-18/h13-16,18-20H,2-12H2,1H3,(H,21,22) |
| InChIKey | OUHGEXHKSPTGKJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |