C10H16N2O — CID 175647238
1-butyl-4,6-dimethylpyrimidin-2-one (PubChem CID 175647238) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-butyl-4,6-dimethylpyrimidin-2-one.
| Compound Name | 1-butyl-4,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 175647238 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-butyl-4,6-dimethylpyrimidin-2-one |
| SMILES | CCCCn1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C10H16N2O/c1-4-5-6-12-9(3)7-8(2)11-10(12)13/h7H,4-6H2,1-3H3 |
| InChIKey | TYKHUQQUAOQYKH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |