C20H26N2O4 — CID 175647374
(5Z)-5-[(6,8-ditert-butyl-2,3-dihydro-1,4-benzodioxin-5-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 175647374) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (5Z)-5-[(6,8-ditert-butyl-2,3-dihydro-1,4-benzodioxin-5-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(6,8-ditert-butyl-2,3-dihydro-1,4-benzodioxin-5-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175647374 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (5Z)-5-[(6,8-ditert-butyl-2,3-dihydro-1,4-benzodioxin-5-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1/C=C1\NC(=O)NC1=O)OCCO2 |
| InChI | InChI=1S/C20H26N2O4/c1-19(2,3)12-10-13(20(4,5)6)16-15(25-7-8-26-16)11(12)9-14-17(23)22-18(24)21-14/h9-10H,7-8H2,1-6H3,(H2,21,22,23,24)/b14-9- |
| InChIKey | NCMDLLXVXWVZBW-ZROIWOOFSA-N |
| XLogP | 3.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|