C34H26N4O2 — CID 175647489
3-[4-[4-(2,3-dicyanophenoxy)-2,3,5-trimethylphenyl]-2,3,6-trimethylphenoxy]benzene-1,2-dicarbonitrile (PubChem CID 175647489) has the molecular formula C34H26N4O2 and a molecular weight of 522.61 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dicyanophenoxy)-2,3,5-trimethylphenyl]-2,3,6-trimethylphenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[4-[4-(2,3-dicyanophenoxy)-2,3,5-trimethylphenyl]-2,3,6-trimethylphenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 175647489 |
| Molecular Formula | C34H26N4O2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 3-[4-[4-(2,3-dicyanophenoxy)-2,3,5-trimethylphenyl]-2,3,6-trimethylphenoxy]benzene-1,2-dicarbonitrile |
| SMILES | Cc1cc(-c2cc(C)c(Oc3cccc(C#N)c3C#N)c(C)c2C)c(C)c(C)c1Oc1cccc(C#N)c1C#N |
| InChI | InChI=1S/C34H26N4O2/c1-19-13-27(21(3)23(5)33(19)39-31-11-7-9-25(15-35)29(31)17-37)28-14-20(2)34(24(6)22(28)4)40-32-12-8-10-26(16-36)30(32)18-38/h7-14H,1-6H3 |
| InChIKey | YUDFDNJGMMGLNY-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |