C19H18ClN5O — CID 175651012
N-[1-(6-chloroquinoxalin-2-yl)piperidin-3-yl]pyridine-3-carboxamide (PubChem CID 175651012) has the molecular formula C19H18ClN5O and a molecular weight of 367.84 g/mol. Its IUPAC name is N-[1-(6-chloroquinoxalin-2-yl)piperidin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(6-chloroquinoxalin-2-yl)piperidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175651012 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[1-(6-chloroquinoxalin-2-yl)piperidin-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCN(c2cnc3cc(Cl)ccc3n2)C1)c1cccnc1 |
| InChI | InChI=1S/C19H18ClN5O/c20-14-5-6-16-17(9-14)22-11-18(24-16)25-8-2-4-15(12-25)23-19(26)13-3-1-7-21-10-13/h1,3,5-7,9-11,15H,2,4,8,12H2,(H,23,26) |
| InChIKey | XYGDFAZAFJUPDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |