C16H18N4O3 — CID 175651292
2,3-dimethyl-6-[(3-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 175651292) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2,3-dimethyl-6-[(3-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2,3-dimethyl-6-[(3-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 175651292 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2,3-dimethyl-6-[(3-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CN(Cc1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C16H18N4O3/c1-11-17-15-6-7-19(10-14(15)16(21)18(11)2)9-12-4-3-5-13(8-12)20(22)23/h3-5,8H,6-7,9-10H2,1-2H3 |
| InChIKey | BIMCPZOAAYPXNE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|