C21H22N2O3 — CID 175651926
6-methoxy-N-(4-methylphenyl)-1-oxo-2-propylisoquinoline-3-carboxamide (PubChem CID 175651926) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-methoxy-N-(4-methylphenyl)-1-oxo-2-propylisoquinoline-3-carboxamide.
| Compound Name | 6-methoxy-N-(4-methylphenyl)-1-oxo-2-propylisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 175651926 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 6-methoxy-N-(4-methylphenyl)-1-oxo-2-propylisoquinoline-3-carboxamide |
| SMILES | CCCn1c(C(=O)Nc2ccc(C)cc2)cc2cc(OC)ccc2c1=O |
| InChI | InChI=1S/C21H22N2O3/c1-4-11-23-19(20(24)22-16-7-5-14(2)6-8-16)13-15-12-17(26-3)9-10-18(15)21(23)25/h5-10,12-13H,4,11H2,1-3H3,(H,22,24) |
| InChIKey | PYJXOPXVZHFQBG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |