C15H17BrN4 — CID 175652074
6-bromo-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)quinazoline (PubChem CID 175652074) has the molecular formula C15H17BrN4 and a molecular weight of 333.23 g/mol. Its IUPAC name is 6-bromo-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)quinazoline.
| Compound Name | 6-bromo-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)quinazoline |
|---|---|
| PubChem CID | 175652074 |
| Molecular Formula | C15H17BrN4 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 6-bromo-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)quinazoline |
| SMILES | CN1CC2CN(c3ncnc4ccc(Br)cc34)CC2C1 |
| InChI | InChI=1S/C15H17BrN4/c1-19-5-10-7-20(8-11(10)6-19)15-13-4-12(16)2-3-14(13)17-9-18-15/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | ZQLFNAULKPXTPH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |