C17H25N5O — CID 175652614
(5-tert-butyl-1H-pyrazol-3-yl)-[2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 175652614) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (5-tert-butyl-1H-pyrazol-3-yl)-[2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (5-tert-butyl-1H-pyrazol-3-yl)-[2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 175652614 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (5-tert-butyl-1H-pyrazol-3-yl)-[2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cn[nH]c1C1CCCCN1C(=O)c1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C17H25N5O/c1-11-10-18-21-15(11)13-7-5-6-8-22(13)16(23)12-9-14(20-19-12)17(2,3)4/h9-10,13H,5-8H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | QBOQSNJVIPIPDJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |