C23H29N3O7 — CID 175652884
2-[2-(4-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylphenyl)acetamide;oxalic acid (PubChem CID 175652884) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylphenyl)acetamide;oxalic acid.
| Compound Name | 2-[2-(4-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylphenyl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 175652884 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylphenyl)acetamide;oxalic acid |
| SMILES | COc1ccc(CCNCC(=O)Nc2ccccc2N2CCOCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27N3O3.C2H2O4/c1-26-18-8-6-17(7-9-18)10-11-22-16-21(25)23-19-4-2-3-5-20(19)24-12-14-27-15-13-24;3-1(4)2(5)6/h2-9,22H,10-16H2,1H3,(H,23,25);(H,3,4)(H,5,6) |
| InChIKey | ILYJZVHBCQKXTP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|