C16H17N3O5 — CID 175652905
oxalic acid;N-phenyl-2-(pyridin-3-ylmethylamino)acetamide (PubChem CID 175652905) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is oxalic acid;N-phenyl-2-(pyridin-3-ylmethylamino)acetamide.
| Compound Name | oxalic acid;N-phenyl-2-(pyridin-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 175652905 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | oxalic acid;N-phenyl-2-(pyridin-3-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1cccnc1)Nc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H15N3O.C2H2O4/c18-14(17-13-6-2-1-3-7-13)11-16-10-12-5-4-8-15-9-12;3-1(4)2(5)6/h1-9,16H,10-11H2,(H,17,18);(H,3,4)(H,5,6) |
| InChIKey | BABLRYOSQGFGSW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|