C26H25NO5 — CID 175653890
(2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)butanoic acid (PubChem CID 175653890) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)butanoic acid.
| Compound Name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 175653890 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)butanoic acid |
| SMILES | COc1ccc([C@@H](C)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-16(17-11-13-18(31-2)14-12-17)24(25(28)29)27-26(30)32-15-23-21-9-5-3-7-19(21)20-8-4-6-10-22(20)23/h3-14,16,23-24H,15H2,1-2H3,(H,27,30)(H,28,29)/t16-,24-/m1/s1 |
| InChIKey | ZYISJENTQITBJK-VOIUYBSRSA-N |
| XLogP | 4.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |