C28H38N2O3 — CID 175654809
3-cyclohexyl-N-[4-[2-(1-ethylpiperidin-2-yl)ethoxy]phenyl]-4-hydroxybenzamide (PubChem CID 175654809) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-[2-(1-ethylpiperidin-2-yl)ethoxy]phenyl]-4-hydroxybenzamide.
| Compound Name | 3-cyclohexyl-N-[4-[2-(1-ethylpiperidin-2-yl)ethoxy]phenyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 175654809 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 3-cyclohexyl-N-[4-[2-(1-ethylpiperidin-2-yl)ethoxy]phenyl]-4-hydroxybenzamide |
| SMILES | CCN1CCCCC1CCOc1ccc(NC(=O)c2ccc(O)c(C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C28H38N2O3/c1-2-30-18-7-6-10-24(30)17-19-33-25-14-12-23(13-15-25)29-28(32)22-11-16-27(31)26(20-22)21-8-4-3-5-9-21/h11-16,20-21,24,31H,2-10,17-19H2,1H3,(H,29,32) |
| InChIKey | GWLQMRSJNPPEAQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |