C17H23N5O — CID 175655568
1-[4-[3-[(dimethylamino)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 175655568) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-[4-[3-[(dimethylamino)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[(dimethylamino)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175655568 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[4-[3-[(dimethylamino)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2ccnc3c(CN(C)C)cnn23)CC1 |
| InChI | InChI=1S/C17H23N5O/c1-4-16(23)21-9-6-13(7-10-21)15-5-8-18-17-14(12-20(2)3)11-19-22(15)17/h4-5,8,11,13H,1,6-7,9-10,12H2,2-3H3 |
| InChIKey | TUEABFOVCDICRC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|