C26H33N5O2 — CID 175655966
1-[10-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone (PubChem CID 175655966) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-[10-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone.
| Compound Name | 1-[10-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone |
|---|---|
| PubChem CID | 175655966 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 1-[10-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone |
| SMILES | CC(=O)N1CCCCCCCN(C(=O)c2cc(C)nc3c2c(C)nn3C)Cc2ccccc21 |
| InChI | InChI=1S/C26H33N5O2/c1-18-16-22(24-19(2)28-29(4)25(24)27-18)26(33)30-14-10-6-5-7-11-15-31(20(3)32)23-13-9-8-12-21(23)17-30/h8-9,12-13,16H,5-7,10-11,14-15,17H2,1-4H3 |
| InChIKey | HCDONBNNFKVNFC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |