C32H45N3O5S — CID 175656338
N-(1,1-dioxothiolan-3-yl)-3-(9-oxo-11-propan-2-yl-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenylethyl)propanamide (PubChem CID 175656338) has the molecular formula C32H45N3O5S and a molecular weight of 583.80 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(9-oxo-11-propan-2-yl-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenylethyl)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(9-oxo-11-propan-2-yl-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 175656338 |
| Molecular Formula | C32H45N3O5S |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(9-oxo-11-propan-2-yl-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenylethyl)propanamide |
| SMILES | CC(C)N1CC(=O)NCCCCCOc2ccc(CCC(=O)N(CCc3ccccc3)C3CCS(=O)(=O)C3)cc2C1 |
| InChI | InChI=1S/C32H45N3O5S/c1-25(2)34-22-28-21-27(11-13-30(28)40-19-8-4-7-17-33-31(36)23-34)12-14-32(37)35(29-16-20-41(38,39)24-29)18-15-26-9-5-3-6-10-26/h3,5-6,9-11,13,21,25,29H,4,7-8,12,14-20,22-24H2,1-2H3,(H,33,36) |
| InChIKey | XPNCVSOHBLMHDQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |