C17H21ClN4O2S — CID 175656495
3-amino-6-[1-(2-chloroacetyl)-3-methylpiperidin-3-yl]-N-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 175656495) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 3-amino-6-[1-(2-chloroacetyl)-3-methylpiperidin-3-yl]-N-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-6-[1-(2-chloroacetyl)-3-methylpiperidin-3-yl]-N-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175656495 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-amino-6-[1-(2-chloroacetyl)-3-methylpiperidin-3-yl]-N-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1sc2nc(C3(C)CCCN(C(=O)CCl)C3)ccc2c1N |
| InChI | InChI=1S/C17H21ClN4O2S/c1-17(6-3-7-22(9-17)12(23)8-18)11-5-4-10-13(19)14(15(24)20-2)25-16(10)21-11/h4-5H,3,6-9,19H2,1-2H3,(H,20,24) |
| InChIKey | LDDOIRJNCDNQTB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|