C24H29N7O2 — CID 175656595
9-benzyl-N-(2-methoxyethyl)-2-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-2-yl]purin-6-amine (PubChem CID 175656595) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 9-benzyl-N-(2-methoxyethyl)-2-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-2-yl]purin-6-amine.
| Compound Name | 9-benzyl-N-(2-methoxyethyl)-2-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 175656595 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 9-benzyl-N-(2-methoxyethyl)-2-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-2-yl]purin-6-amine |
| SMILES | COCCNc1nc(C2CCCN2Cc2cc(C)on2)nc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C24H29N7O2/c1-17-13-19(29-33-17)15-30-11-6-9-20(30)22-27-23(25-10-12-32-2)21-24(28-22)31(16-26-21)14-18-7-4-3-5-8-18/h3-5,7-8,13,16,20H,6,9-12,14-15H2,1-2H3,(H,25,27,28) |
| InChIKey | XHCUMQIOOHEGGD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|