C18H23N3OS — CID 175656775
5-[[(3aR,4R,6aS)-4-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]-4-methyl-1,3-thiazole (PubChem CID 175656775) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 5-[[(3aR,4R,6aS)-4-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[[(3aR,4R,6aS)-4-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 175656775 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 5-[[(3aR,4R,6aS)-4-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1ncccc1O[C@@H]1CC[C@@H]2CN(Cc3scnc3C)C[C@@H]21 |
| InChI | InChI=1S/C18H23N3OS/c1-12-16(4-3-7-19-12)22-17-6-5-14-8-21(9-15(14)17)10-18-13(2)20-11-23-18/h3-4,7,11,14-15,17H,5-6,8-10H2,1-2H3/t14-,15+,17-/m1/s1 |
| InChIKey | ZDUDTMOJHWPSNS-HLLBOEOZSA-N |
| XLogP | 3.44 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |