C17H20N4O2S — CID 175657439
3-amino-N-methyl-6-[1-(2-methylprop-2-enoyl)pyrrolidin-2-yl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 175657439) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-amino-N-methyl-6-[1-(2-methylprop-2-enoyl)pyrrolidin-2-yl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-methyl-6-[1-(2-methylprop-2-enoyl)pyrrolidin-2-yl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175657439 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-amino-N-methyl-6-[1-(2-methylprop-2-enoyl)pyrrolidin-2-yl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C=C(C)C(=O)N1CCCC1c1ccc2c(N)c(C(=O)NC)sc2n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-9(2)17(23)21-8-4-5-12(21)11-7-6-10-13(18)14(15(22)19-3)24-16(10)20-11/h6-7,12H,1,4-5,8,18H2,2-3H3,(H,19,22) |
| InChIKey | VGHNLFTZPKWEGX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|