C19H24F3N7O2S — CID 175657884
N-(2-methoxyethyl)-2-[4-[(5-methyl-1,3-thiazol-2-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine (PubChem CID 175657884) has the molecular formula C19H24F3N7O2S and a molecular weight of 471.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-[(5-methyl-1,3-thiazol-2-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine.
| Compound Name | N-(2-methoxyethyl)-2-[4-[(5-methyl-1,3-thiazol-2-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine |
|---|---|
| PubChem CID | 175657884 |
| Molecular Formula | C19H24F3N7O2S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-[(5-methyl-1,3-thiazol-2-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine |
| SMILES | COCCNc1nc(C2CN(Cc3ncc(C)s3)CCO2)nc2c1ncn2CC(F)(F)F |
| InChI | InChI=1S/C19H24F3N7O2S/c1-12-7-24-14(32-12)9-28-4-6-31-13(8-28)16-26-17(23-3-5-30-2)15-18(27-16)29(11-25-15)10-19(20,21)22/h7,11,13H,3-6,8-10H2,1-2H3,(H,23,26,27) |
| InChIKey | IXSJKDWUFSMBFX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|