C19H23N5O3 — CID 175658274
4-(1-methyl-6-oxopyridazine-3-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide (PubChem CID 175658274) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-(1-methyl-6-oxopyridazine-3-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide.
| Compound Name | 4-(1-methyl-6-oxopyridazine-3-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 175658274 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 4-(1-methyl-6-oxopyridazine-3-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide |
| SMILES | Cn1nc(C(=O)N2CCN(CCc3ccccc3)C(C(N)=O)C2)ccc1=O |
| InChI | InChI=1S/C19H23N5O3/c1-22-17(25)8-7-15(21-22)19(27)24-12-11-23(16(13-24)18(20)26)10-9-14-5-3-2-4-6-14/h2-8,16H,9-13H2,1H3,(H2,20,26) |
| InChIKey | UXWVTXOJTIVEON-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |