C20H23ClN6S — CID 175658564
N-[6-[[1-[(2-chloro-3-pyridinyl)methyl]piperidin-4-yl]methyl]pyrazin-2-yl]-5-methyl-1,3-thiazol-2-amine (PubChem CID 175658564) has the molecular formula C20H23ClN6S and a molecular weight of 414.97 g/mol. Its IUPAC name is N-[6-[[1-[(2-chloro-3-pyridinyl)methyl]piperidin-4-yl]methyl]pyrazin-2-yl]-5-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[6-[[1-[(2-chloro-3-pyridinyl)methyl]piperidin-4-yl]methyl]pyrazin-2-yl]-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 175658564 |
| Molecular Formula | C20H23ClN6S |
| Molecular Weight | 414.97 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[6-[[1-[(2-chloro-3-pyridinyl)methyl]piperidin-4-yl]methyl]pyrazin-2-yl]-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1cnc(Nc2cncc(CC3CCN(Cc4cccnc4Cl)CC3)n2)s1 |
| InChI | InChI=1S/C20H23ClN6S/c1-14-10-24-20(28-14)26-18-12-22-11-17(25-18)9-15-4-7-27(8-5-15)13-16-3-2-6-23-19(16)21/h2-3,6,10-12,15H,4-5,7-9,13H2,1H3,(H,24,25,26) |
| InChIKey | WWZGYXSAFBCGQA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|