C23H26ClNO2 — CID 175658814
N-[4-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenyl]acetamide (PubChem CID 175658814) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is N-[4-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 175658814 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[4-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenyl]acetamide |
| SMILES | C=C(C)[C@@H]1CC[C@@H](Cc2ccc(Cl)cc2)O[C@H]1c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C23H26ClNO2/c1-15(2)22-13-12-21(14-17-4-8-19(24)9-5-17)27-23(22)18-6-10-20(11-7-18)25-16(3)26/h4-11,21-23H,1,12-14H2,2-3H3,(H,25,26)/t21-,22-,23-/m0/s1 |
| InChIKey | LCJJFWCDQWBVTR-VABKMULXSA-N |
| XLogP | 5.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|