C24H24ClN3O2 — CID 175659320
2-(4-benzylpiperidin-1-yl)-4-[(3-chlorophenyl)methyl]pyrimidine-5-carboxylic acid (PubChem CID 175659320) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-4-[(3-chlorophenyl)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-4-[(3-chlorophenyl)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 175659320 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-4-[(3-chlorophenyl)methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCC(Cc3ccccc3)CC2)nc1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClN3O2/c25-20-8-4-7-19(14-20)15-22-21(23(29)30)16-26-24(27-22)28-11-9-18(10-12-28)13-17-5-2-1-3-6-17/h1-8,14,16,18H,9-13,15H2,(H,29,30) |
| InChIKey | OKZZFIJQRFCJSF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |