C29H28Cl2O4 — CID 175659449
2-[4-chloro-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid (PubChem CID 175659449) has the molecular formula C29H28Cl2O4 and a molecular weight of 511.45 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 175659449 |
| Molecular Formula | C29H28Cl2O4 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[4-chloro-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccccc2)[C@H](c2cccc(Cl)c2)O[C@@H]1c1cc(Cl)c(C)cc1OCC(=O)O |
| InChI | InChI=1S/C29H28Cl2O4/c1-17(2)22-14-23(19-8-5-4-6-9-19)28(20-10-7-11-21(30)13-20)35-29(22)24-15-25(31)18(3)12-26(24)34-16-27(32)33/h4-13,15,22-23,28-29H,1,14,16H2,2-3H3,(H,32,33)/t22-,23-,28+,29+/m1/s1 |
| InChIKey | KMKPONRUPKTTSE-JJUMQRNRSA-N |
| XLogP | 7.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|