C29H25ClO3 — CID 175659552
2-[3,5-dibenzyl-4-[(4-chlorophenyl)methoxy]phenyl]acetic acid (PubChem CID 175659552) has the molecular formula C29H25ClO3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 2-[3,5-dibenzyl-4-[(4-chlorophenyl)methoxy]phenyl]acetic acid.
| Compound Name | 2-[3,5-dibenzyl-4-[(4-chlorophenyl)methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 175659552 |
| Molecular Formula | C29H25ClO3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[3,5-dibenzyl-4-[(4-chlorophenyl)methoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Cc2ccccc2)c(OCc2ccc(Cl)cc2)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H25ClO3/c30-27-13-11-23(12-14-27)20-33-29-25(15-21-7-3-1-4-8-21)17-24(19-28(31)32)18-26(29)16-22-9-5-2-6-10-22/h1-14,17-18H,15-16,19-20H2,(H,31,32) |
| InChIKey | ILTRFIZMCKLHCC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |