About 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide
2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide (PubChem CID 175660454) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide |
| PubChem CID | 175660454 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[C@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C8H16N2O2/c1-10(2)8(12)3-6-4-9-5-7(6)11/h6-7,9,11H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | IQZYJNQQHYZZDG-BQBZGAKWSA-N |
| XLogP | -0.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide?
The IUPAC name of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide (CID 175660454) is 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide is CN(C)C(=O)C[C@H]1CNC[C@@H]1O.
What is the InChIKey of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide?
The InChIKey is IQZYJNQQHYZZDG-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-10(2)8(12)3-6-4-9-5-7(6)11/h6-7,9,11H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide?
2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide has a molecular weight of 172.23 g/mol, XLogP of -0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]-N,N-dimethylacetamide is sourced from PubChem (CID 175660454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).