About 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol
4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol (PubChem CID 175660730) has the molecular formula C20H24O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol |
| PubChem CID | 175660730 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol |
| SMILES | CC(C)[C@@H]1C[C@H](c2ccccc2)CO[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C20H24O2/c1-14(2)19-12-17(15-6-4-3-5-7-15)13-22-20(19)16-8-10-18(21)11-9-16/h3-11,14,17,19-21H,12-13H2,1-2H3/t17-,19-,20-/m0/s1 |
| InChIKey | DGDCSYVRAOICMF-IHPCNDPISA-N |
| XLogP | 4.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol?
The IUPAC name of 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol (CID 175660730) is 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol.
What is the SMILES notation for 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol?
The canonical SMILES for 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol is CC(C)[C@@H]1C[C@H](c2ccccc2)CO[C@H]1c1ccc(O)cc1.
What is the InChIKey of 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol?
The InChIKey is DGDCSYVRAOICMF-IHPCNDPISA-N. The full InChI is InChI=1S/C20H24O2/c1-14(2)19-12-17(15-6-4-3-5-7-15)13-22-20(19)16-8-10-18(21)11-9-16/h3-11,14,17,19-21H,12-13H2,1-2H3/t17-,19-,20-/m0/s1.
What are the key properties of 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol?
4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol has a molecular weight of 296.41 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3S,5R)-5-phenyl-3-propan-2-yloxan-2-yl]phenol is sourced from PubChem (CID 175660730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).