About 6-(phenoxymethyl)-1,4-oxazepan-6-ol
6-(phenoxymethyl)-1,4-oxazepan-6-ol (PubChem CID 175661755) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 6-(phenoxymethyl)-1,4-oxazepan-6-ol.
Molecular Properties
| Compound Name | 6-(phenoxymethyl)-1,4-oxazepan-6-ol |
| PubChem CID | 175661755 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 6-(phenoxymethyl)-1,4-oxazepan-6-ol |
| SMILES | OC1(COc2ccccc2)CNCCOC1 |
| InChI | InChI=1S/C12H17NO3/c14-12(8-13-6-7-15-9-12)10-16-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2 |
| InChIKey | FXMMGICCTCUMQR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(phenoxymethyl)-1,4-oxazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(phenoxymethyl)-1,4-oxazepan-6-ol?
The IUPAC name of 6-(phenoxymethyl)-1,4-oxazepan-6-ol (CID 175661755) is 6-(phenoxymethyl)-1,4-oxazepan-6-ol.
What is the SMILES notation for 6-(phenoxymethyl)-1,4-oxazepan-6-ol?
The canonical SMILES for 6-(phenoxymethyl)-1,4-oxazepan-6-ol is OC1(COc2ccccc2)CNCCOC1.
What is the InChIKey of 6-(phenoxymethyl)-1,4-oxazepan-6-ol?
The InChIKey is FXMMGICCTCUMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c14-12(8-13-6-7-15-9-12)10-16-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2.
What are the key properties of 6-(phenoxymethyl)-1,4-oxazepan-6-ol?
6-(phenoxymethyl)-1,4-oxazepan-6-ol has a molecular weight of 223.27 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(phenoxymethyl)-1,4-oxazepan-6-ol is sourced from PubChem (CID 175661755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).