C6H9NO2 — CID 175661920
(3aS,6aS)-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrol-2-one (PubChem CID 175661920) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (3aS,6aS)-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 175661920 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (3aS,6aS)-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrol-2-one |
| SMILES | O=C1C[C@H]2CNC[C@H]2O1 |
| InChI | InChI=1S/C6H9NO2/c8-6-1-4-2-7-3-5(4)9-6/h4-5,7H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | WEFWZFBFVWKWKY-CRCLSJGQSA-N |
| XLogP | -0.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |