C17H15ClO3 — CID 175662582
2-[(3-chlorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-carboxylic acid (PubChem CID 175662582) has the molecular formula C17H15ClO3 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-carboxylic acid.
| Compound Name | 2-[(3-chlorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 175662582 |
| Molecular Formula | C17H15ClO3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-carboxylic acid |
| SMILES | CC1(Cc2cccc(Cl)c2)Cc2cc(C(=O)O)ccc2O1 |
| InChI | InChI=1S/C17H15ClO3/c1-17(9-11-3-2-4-14(18)7-11)10-13-8-12(16(19)20)5-6-15(13)21-17/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | HEIBBBGHLWIXDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |