C38H62O9 — CID 175663334
8-[4-(2,4-dihydroxy-5,6-dimethyloxan-2-yl)-3-hydroxypentan-2-yl]-20-hydroxy-1,3,9,13-tetramethyl-16-pentyl-7,17,19-trioxabicyclo[13.4.1]icosa-2,4,10,12-tetraen-6-one (PubChem CID 175663334) has the molecular formula C38H62O9 and a molecular weight of 662.91 g/mol. Its IUPAC name is 8-[4-(2,4-dihydroxy-5,6-dimethyloxan-2-yl)-3-hydroxypentan-2-yl]-20-hydroxy-1,3,9,13-tetramethyl-16-pentyl-7,17,19-trioxabicyclo[13.4.1]icosa-2,4,10,12-tetraen-6-one.
| Compound Name | 8-[4-(2,4-dihydroxy-5,6-dimethyloxan-2-yl)-3-hydroxypentan-2-yl]-20-hydroxy-1,3,9,13-tetramethyl-16-pentyl-7,17,19-trioxabicyclo[13.4.1]icosa-2,4,10,12-tetraen-6-one |
|---|---|
| PubChem CID | 175663334 |
| Molecular Formula | C38H62O9 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.44 |
| IUPAC Name | 8-[4-(2,4-dihydroxy-5,6-dimethyloxan-2-yl)-3-hydroxypentan-2-yl]-20-hydroxy-1,3,9,13-tetramethyl-16-pentyl-7,17,19-trioxabicyclo[13.4.1]icosa-2,4,10,12-tetraen-6-one |
| SMILES | CCCCCC1OCOC2(C)C=C(C)C=CC(=O)OC(C(C)C(O)C(C)C3(O)CC(O)C(C)C(C)O3)C(C)C=CC=C(C)CC1C2O |
| InChI | InChI=1S/C38H62O9/c1-10-11-12-16-32-30-19-23(2)14-13-15-25(4)35(27(6)34(41)28(7)38(43)21-31(39)26(5)29(8)47-38)46-33(40)18-17-24(3)20-37(9,36(30)42)45-22-44-32/h13-15,17-18,20,25-32,34-36,39,41-43H,10-12,16,19,21-22H2,1-9H3 |
| InChIKey | PVLUIKRBNONGMR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|