C26H30ClN7O4S — CID 175663544
4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 175663544) has the molecular formula C26H30ClN7O4S and a molecular weight of 572.09 g/mol. Its IUPAC name is 4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175663544 |
| Molecular Formula | C26H30ClN7O4S |
| Molecular Weight | 572.09 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-[2-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CN(C)c1nc(NCCNS(=O)(=O)c2ccc(C(=O)/C=C/c3ccc(Cl)cc3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C26H30ClN7O4S/c1-33(2)25-30-24(31-26(32-25)34-15-17-38-18-16-34)28-13-14-29-39(36,37)22-10-6-20(7-11-22)23(35)12-5-19-3-8-21(27)9-4-19/h3-12,29H,13-18H2,1-2H3,(H,28,30,31,32)/b12-5+ |
| InChIKey | DJAWBGHBXPKNPI-LFYBBSHMSA-N |
| XLogP | 2.71 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|