C34H36ClFN6O2 — CID 175664033
1-[(3R)-3-[[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 175664033) has the molecular formula C34H36ClFN6O2 and a molecular weight of 615.15 g/mol. Its IUPAC name is 1-[(3R)-3-[[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175664033 |
| Molecular Formula | C34H36ClFN6O2 |
| Molecular Weight | 615.15 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 1-[(3R)-3-[[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](N(C)c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(Cl)c45)ncc23)C1 |
| InChI | InChI=1S/C34H36ClFN6O2/c1-3-27(43)41-16-6-11-23(20-41)40(2)32-25-19-37-30(24-12-4-9-22-10-5-13-26(35)28(22)24)29(36)31(25)38-33(39-32)44-21-34-14-7-17-42(34)18-8-15-34/h3-5,9-10,12-13,19,23H,1,6-8,11,14-18,20-21H2,2H3/t23-/m1/s1 |
| InChIKey | OWTCOYMJMITFIC-HSZRJFAPSA-N |
| XLogP | 6.26 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.15 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|