C31H30ClF2N7O — CID 175664062
(3R)-3-[[7-(8-chloro-7-fluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile (PubChem CID 175664062) has the molecular formula C31H30ClF2N7O and a molecular weight of 590.08 g/mol. Its IUPAC name is (3R)-3-[[7-(8-chloro-7-fluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile.
| Compound Name | (3R)-3-[[7-(8-chloro-7-fluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 175664062 |
| Molecular Formula | C31H30ClF2N7O |
| Molecular Weight | 590.08 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (3R)-3-[[7-(8-chloro-7-fluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile |
| SMILES | CN(c1nc(OCC23CCCN2CCC3)nc2c(F)c(-c3cccc4ccc(F)c(Cl)c34)ncc12)[C@@H]1CCN(C#N)C1 |
| InChI | InChI=1S/C31H30ClF2N7O/c1-39(20-9-14-40(16-20)18-35)29-22-15-36-27(21-6-2-5-19-7-8-23(33)25(32)24(19)21)26(34)28(22)37-30(38-29)42-17-31-10-3-12-41(31)13-4-11-31/h2,5-8,15,20H,3-4,9-14,16-17H2,1H3/t20-/m1/s1 |
| InChIKey | HEZMIDDXQCDNOM-HXUWFJFHSA-N |
| XLogP | 5.78 |
| TPSA | 81.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.08 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|