C23H20F5N3O2 — CID 175664675
(3S)-3-(3,5-difluorophenyl)-1'-(3,4,5-trifluorobenzoyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one (PubChem CID 175664675) has the molecular formula C23H20F5N3O2 and a molecular weight of 465.42 g/mol. Its IUPAC name is (3S)-3-(3,5-difluorophenyl)-1'-(3,4,5-trifluorobenzoyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one.
| Compound Name | (3S)-3-(3,5-difluorophenyl)-1'-(3,4,5-trifluorobenzoyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 175664675 |
| Molecular Formula | C23H20F5N3O2 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (3S)-3-(3,5-difluorophenyl)-1'-(3,4,5-trifluorobenzoyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)N1CCC2(CC1)CN1CC[C@@H](c3cc(F)cc(F)c3)N1C2=O |
| InChI | InChI=1S/C23H20F5N3O2/c24-15-7-13(8-16(25)11-15)19-1-4-30-12-23(22(33)31(19)30)2-5-29(6-3-23)21(32)14-9-17(26)20(28)18(27)10-14/h7-11,19H,1-6,12H2/t19-/m0/s1 |
| InChIKey | GGWBLQNTHFEKOB-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|