C22H22F3N3O — CID 175664697
(3S)-3-(3,5-difluorophenyl)-1'-(4-fluorophenyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one (PubChem CID 175664697) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is (3S)-3-(3,5-difluorophenyl)-1'-(4-fluorophenyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one.
| Compound Name | (3S)-3-(3,5-difluorophenyl)-1'-(4-fluorophenyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 175664697 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (3S)-3-(3,5-difluorophenyl)-1'-(4-fluorophenyl)spiro[1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazole-6,4'-piperidine]-5-one |
| SMILES | O=C1N2[C@H](c3cc(F)cc(F)c3)CCN2CC12CCN(c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H22F3N3O/c23-16-1-3-19(4-2-16)26-9-6-22(7-10-26)14-27-8-5-20(28(27)21(22)29)15-11-17(24)13-18(25)12-15/h1-4,11-13,20H,5-10,14H2/t20-/m0/s1 |
| InChIKey | SIRDYQZMAZNJLU-FQEVSTJZSA-N |
| XLogP | 3.89 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |