About 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine
2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine (PubChem CID 175664799) has the molecular formula C13H16F3N3O3S
and a molecular weight of 351.35 g/mol. Its IUPAC name is 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine |
| PubChem CID | 175664799 |
| Molecular Formula | C13H16F3N3O3S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine |
| SMILES | NCC(=CF)COc1ccc(S(=O)(=O)N2CCC(F)(F)C2)cn1 |
| InChI | InChI=1S/C13H16F3N3O3S/c14-5-10(6-17)8-22-12-2-1-11(7-18-12)23(20,21)19-4-3-13(15,16)9-19/h1-2,5,7H,3-4,6,8-9,17H2 |
| InChIKey | XSKJOFPCLAPSLQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine?
The IUPAC name of 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine (CID 175664799) is 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine.
What is the SMILES notation for 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine?
The canonical SMILES for 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine is NCC(=CF)COc1ccc(S(=O)(=O)N2CCC(F)(F)C2)cn1.
What is the InChIKey of 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine?
The InChIKey is XSKJOFPCLAPSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N3O3S/c14-5-10(6-17)8-22-12-2-1-11(7-18-12)23(20,21)19-4-3-13(15,16)9-19/h1-2,5,7H,3-4,6,8-9,17H2.
What are the key properties of 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine?
2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine has a molecular weight of 351.35 g/mol, XLogP of 1.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3,3-difluoropyrrolidin-1-yl)sulfonyl-2-pyridinyl]oxymethyl]-3-fluoroprop-2-en-1-amine is sourced from PubChem (CID 175664799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).