C35H29N5O3 — CID 175664950
4-[[2-[4-[2-[[4-(5-methanimidoyl-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]benzoic acid (PubChem CID 175664950) has the molecular formula C35H29N5O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is 4-[[2-[4-[2-[[4-(5-methanimidoyl-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-[2-[[4-(5-methanimidoyl-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 175664950 |
| Molecular Formula | C35H29N5O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 4-[[2-[4-[2-[[4-(5-methanimidoyl-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]benzoic acid |
| SMILES | [H]/N=C/c1ccc(-c2ccc(COCCc3ccc(-c4nc5ccccn5c4Nc4ccc(C(=O)O)cc4)cc3)cc2)nc1 |
| InChI | InChI=1S/C35H29N5O3/c36-21-26-8-17-31(37-22-26)27-9-6-25(7-10-27)23-43-20-18-24-4-11-28(12-5-24)33-34(40-19-2-1-3-32(40)39-33)38-30-15-13-29(14-16-30)35(41)42/h1-17,19,21-22,36,38H,18,20,23H2,(H,41,42)/b36-21+ |
| InChIKey | AFRSAOZBABHTMD-QLQYKETESA-N |
| XLogP | 7.26 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|