C41H31N5O3 — CID 175664951
4-[[2-[4-[2-[[4-(5-cyano-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]-7-phenylimidazo[1,2-a]pyridin-3-yl]amino]benzoic acid (PubChem CID 175664951) has the molecular formula C41H31N5O3 and a molecular weight of 641.73 g/mol. Its IUPAC name is 4-[[2-[4-[2-[[4-(5-cyano-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]-7-phenylimidazo[1,2-a]pyridin-3-yl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-[2-[[4-(5-cyano-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]-7-phenylimidazo[1,2-a]pyridin-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 175664951 |
| Molecular Formula | C41H31N5O3 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | 4-[[2-[4-[2-[[4-(5-cyano-2-pyridinyl)phenyl]methoxy]ethyl]phenyl]-7-phenylimidazo[1,2-a]pyridin-3-yl]amino]benzoic acid |
| SMILES | N#Cc1ccc(-c2ccc(COCCc3ccc(-c4nc5cc(-c6ccccc6)ccn5c4Nc4ccc(C(=O)O)cc4)cc3)cc2)nc1 |
| InChI | InChI=1S/C41H31N5O3/c42-25-30-10-19-37(43-26-30)32-11-8-29(9-12-32)27-49-23-21-28-6-13-33(14-7-28)39-40(44-36-17-15-34(16-18-36)41(47)48)46-22-20-35(24-38(46)45-39)31-4-2-1-3-5-31/h1-20,22,24,26,44H,21,23,27H2,(H,47,48) |
| InChIKey | YGUMZIVVKCXWRC-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|