C13H20O3 — CID 175664970
(3'S,3'aR,7'aS)-3',7'a-dimethylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one (PubChem CID 175664970) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3'S,3'aR,7'aS)-3',7'a-dimethylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one.
| Compound Name | (3'S,3'aR,7'aS)-3',7'a-dimethylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one |
|---|---|
| PubChem CID | 175664970 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3'S,3'aR,7'aS)-3',7'a-dimethylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one |
| SMILES | C[C@H]1CC(=O)[C@@]2(C)CCC3(C[C@H]12)OCCO3 |
| InChI | InChI=1S/C13H20O3/c1-9-7-11(14)12(2)3-4-13(8-10(9)12)15-5-6-16-13/h9-10H,3-8H2,1-2H3/t9-,10+,12-/m0/s1 |
| InChIKey | OYPMNWMOVMKKGW-UMNHJUIQSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |