About CID 175665005
CID 175665005 (PubChem CID 175665005) has the molecular formula C19H4Br6Cl5
and a molecular weight of 888.93 g/mol.
Molecular Properties
| Compound Name | CID 175665005 |
| PubChem CID | 175665005 |
| Molecular Formula | C19H4Br6Cl5 |
| Molecular Weight | 888.93 g/mol |
| Exact Mass | 880.39 |
| IUPAC Name | — |
| SMILES | Cl[C]1C(Cl)=C(Cl)C(=C(c2c(Br)cc(Br)cc2Br)c2c(Br)cc(Br)cc2Br)C(Cl)=C1Cl |
| InChI | InChI=1S/C19H4Br6Cl5/c20-5-1-7(22)11(8(23)2-5)13(12-9(24)3-6(21)4-10(12)25)14-15(26)17(28)19(30)18(29)16(14)27/h1-4H |
| InChIKey | XXXLAPKRTGZHDO-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 888.93 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 175665005 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175665005?
The IUPAC name of CID 175665005 (CID 175665005) is not available.
What is the SMILES notation for CID 175665005?
The canonical SMILES for CID 175665005 is Cl[C]1C(Cl)=C(Cl)C(=C(c2c(Br)cc(Br)cc2Br)c2c(Br)cc(Br)cc2Br)C(Cl)=C1Cl.
What is the InChIKey of CID 175665005?
The InChIKey is XXXLAPKRTGZHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H4Br6Cl5/c20-5-1-7(22)11(8(23)2-5)13(12-9(24)3-6(21)4-10(12)25)14-15(26)17(28)19(30)18(29)16(14)27/h1-4H.
What are the key properties of CID 175665005?
CID 175665005 has a molecular weight of 888.93 g/mol, XLogP of 12.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175665005 is sourced from PubChem (CID 175665005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).