C15H17NO3 — CID 175665160
[(1R,5R,6S)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octan-6-yl] benzoate (PubChem CID 175665160) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is [(1R,5R,6S)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octan-6-yl] benzoate.
| Compound Name | [(1R,5R,6S)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
|---|---|
| PubChem CID | 175665160 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [(1R,5R,6S)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
| SMILES | CN1[C@H]2CC(=O)C[C@@H]1[C@@H](OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H17NO3/c1-16-11-7-12(17)9-13(16)14(8-11)19-15(18)10-5-3-2-4-6-10/h2-6,11,13-14H,7-9H2,1H3/t11-,13+,14-/m0/s1 |
| InChIKey | DHGHELHQURKJKF-YUTCNCBUSA-N |
| XLogP | 1.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |